C13H15Cl2NO9S2 — CID 172953011
[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1Z)-2,3-dichloro-N-sulfooxybenzenecarboximidothioate (PubChem CID 172953011) has the molecular formula C13H15Cl2NO9S2 and a molecular weight of 464.30 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1Z)-2,3-dichloro-N-sulfooxybenzenecarboximidothioate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1Z)-2,3-dichloro-N-sulfooxybenzenecarboximidothioate |
|---|---|
| PubChem CID | 172953011 |
| Molecular Formula | C13H15Cl2NO9S2 |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 462.96 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1Z)-2,3-dichloro-N-sulfooxybenzenecarboximidothioate |
| SMILES | O=S(=O)(O)O/N=C(\S[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H15Cl2NO9S2/c14-6-3-1-2-5(8(6)15)12(16-25-27(21,22)23)26-13-11(20)10(19)9(18)7(4-17)24-13/h1-3,7,9-11,13,17-20H,4H2,(H,21,22,23)/b16-12-/t7-,9-,10+,11-,13-/m1/s1 |
| InChIKey | XJZIRWADHDNGON-VHWITBMBSA-N |
| XLogP | 0.01 |
| TPSA | 166.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|