C24H34N2O3 — CID 172953116
5-[(3E,10S,13R,17S)-14-amino-3-hydroxyimino-10,13-dimethyl-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one (PubChem CID 172953116) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 5-[(3E,10S,13R,17S)-14-amino-3-hydroxyimino-10,13-dimethyl-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one.
| Compound Name | 5-[(3E,10S,13R,17S)-14-amino-3-hydroxyimino-10,13-dimethyl-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
|---|---|
| PubChem CID | 172953116 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 5-[(3E,10S,13R,17S)-14-amino-3-hydroxyimino-10,13-dimethyl-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
| SMILES | C[C@]12CC/C(=N\O)CC1CCC1C2CC[C@]2(C)[C@@H](c3ccc(=O)oc3)CCC12N |
| InChI | InChI=1S/C24H34N2O3/c1-22-10-7-17(26-28)13-16(22)4-5-20-19(22)8-11-23(2)18(9-12-24(20,23)25)15-3-6-21(27)29-14-15/h3,6,14,16,18-20,28H,4-5,7-13,25H2,1-2H3/b26-17+/t16?,18-,19?,20?,22+,23-,24?/m1/s1 |
| InChIKey | KXGPWAOPDBVLCB-DCVBJHJGSA-N |
| XLogP | 4.68 |
| TPSA | 88.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|