C27H32N2O2 — CID 172953558
5-butyl-4-methyl-3-phenyl-1,2-oxazole;(NZ)-N-(1-phenylhept-2-ynylidene)hydroxylamine (PubChem CID 172953558) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 5-butyl-4-methyl-3-phenyl-1,2-oxazole;(NZ)-N-(1-phenylhept-2-ynylidene)hydroxylamine.
| Compound Name | 5-butyl-4-methyl-3-phenyl-1,2-oxazole;(NZ)-N-(1-phenylhept-2-ynylidene)hydroxylamine |
|---|---|
| PubChem CID | 172953558 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 5-butyl-4-methyl-3-phenyl-1,2-oxazole;(NZ)-N-(1-phenylhept-2-ynylidene)hydroxylamine |
| SMILES | CCCCC#C/C(=N\O)c1ccccc1.CCCCc1onc(-c2ccccc2)c1C |
| InChI | InChI=1S/C14H17NO.C13H15NO/c1-3-4-10-13-11(2)14(15-16-13)12-8-6-5-7-9-12;1-2-3-4-8-11-13(14-15)12-9-6-5-7-10-12/h5-9H,3-4,10H2,1-2H3;5-7,9-10,15H,2-4H2,1H3/b;14-13+ |
| InChIKey | NAHMIMAVZDDUPG-SLTJUJPSSA-N |
| XLogP | 7.05 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|