C32H35N7O3 — CID 172958287
methyl N-[(2S)-3,3-dimethyl-1-oxo-1-[(2E)-2-[(4-pyridin-2-ylphenyl)methylidene]hydrazinyl]butan-2-yl]carbamate;(E)-(4-pyridin-2-ylphenyl)methylidenehydrazine (PubChem CID 172958287) has the molecular formula C32H35N7O3 and a molecular weight of 565.68 g/mol. Its IUPAC name is methyl N-[(2S)-3,3-dimethyl-1-oxo-1-[(2E)-2-[(4-pyridin-2-ylphenyl)methylidene]hydrazinyl]butan-2-yl]carbamate;(E)-(4-pyridin-2-ylphenyl)methylidenehydrazine.
| Compound Name | methyl N-[(2S)-3,3-dimethyl-1-oxo-1-[(2E)-2-[(4-pyridin-2-ylphenyl)methylidene]hydrazinyl]butan-2-yl]carbamate;(E)-(4-pyridin-2-ylphenyl)methylidenehydrazine |
|---|---|
| PubChem CID | 172958287 |
| Molecular Formula | C32H35N7O3 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.28 |
| IUPAC Name | methyl N-[(2S)-3,3-dimethyl-1-oxo-1-[(2E)-2-[(4-pyridin-2-ylphenyl)methylidene]hydrazinyl]butan-2-yl]carbamate;(E)-(4-pyridin-2-ylphenyl)methylidenehydrazine |
| SMILES | COC(=O)N[C@H](C(=O)N/N=C/c1ccc(-c2ccccn2)cc1)C(C)(C)C.N/N=C/c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C20H24N4O3.C12H11N3/c1-20(2,3)17(23-19(26)27-4)18(25)24-22-13-14-8-10-15(11-9-14)16-7-5-6-12-21-16;13-15-9-10-4-6-11(7-5-10)12-3-1-2-8-14-12/h5-13,17H,1-4H3,(H,23,26)(H,24,25);1-9H,13H2/b22-13+;15-9+/t17-;/m1./s1 |
| InChIKey | UJMPODKIPJKVES-ZAWXACEKSA-N |
| XLogP | 5.01 |
| TPSA | 143.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|