C30H39N5O4 — CID 20638774
methyl N-[(2S)-1-[[(S)-[amino-[(2S)-2-hydroxy-4-phenylbutyl]amino]-(4-pyridin-2-ylphenyl)methyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 20638774) has the molecular formula C30H39N5O4 and a molecular weight of 533.67 g/mol. Its IUPAC name is methyl N-[(2S)-1-[[(S)-[amino-[(2S)-2-hydroxy-4-phenylbutyl]amino]-(4-pyridin-2-ylphenyl)methyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[[(S)-[amino-[(2S)-2-hydroxy-4-phenylbutyl]amino]-(4-pyridin-2-ylphenyl)methyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 20638774 |
| Molecular Formula | C30H39N5O4 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | methyl N-[(2S)-1-[[(S)-[amino-[(2S)-2-hydroxy-4-phenylbutyl]amino]-(4-pyridin-2-ylphenyl)methyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N[C@H](c1ccc(-c2ccccn2)cc1)N(N)C[C@@H](O)CCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H39N5O4/c1-30(2,3)26(33-29(38)39-4)28(37)34-27(23-16-14-22(15-17-23)25-12-8-9-19-32-25)35(31)20-24(36)18-13-21-10-6-5-7-11-21/h5-12,14-17,19,24,26-27,36H,13,18,20,31H2,1-4H3,(H,33,38)(H,34,37)/t24-,26+,27-/m0/s1 |
| InChIKey | YOTQZONQJVKPAV-OIKPOIBNSA-N |
| XLogP | 3.80 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|