C31H40N4O4 — CID 68974297
methyl N-[1-[[6-(4-aminophenyl)-2-hydroxy-5-(4-pyridin-2-ylphenyl)hexyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 68974297) has the molecular formula C31H40N4O4 and a molecular weight of 532.69 g/mol. Its IUPAC name is methyl N-[1-[[6-(4-aminophenyl)-2-hydroxy-5-(4-pyridin-2-ylphenyl)hexyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[1-[[6-(4-aminophenyl)-2-hydroxy-5-(4-pyridin-2-ylphenyl)hexyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 68974297 |
| Molecular Formula | C31H40N4O4 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | methyl N-[1-[[6-(4-aminophenyl)-2-hydroxy-5-(4-pyridin-2-ylphenyl)hexyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)NC(C(=O)NCC(O)CCC(Cc1ccc(N)cc1)c1ccc(-c2ccccn2)cc1)C(C)(C)C |
| InChI | InChI=1S/C31H40N4O4/c1-31(2,3)28(35-30(38)39-4)29(37)34-20-26(36)17-14-24(19-21-8-15-25(32)16-9-21)22-10-12-23(13-11-22)27-7-5-6-18-33-27/h5-13,15-16,18,24,26,28,36H,14,17,19-20,32H2,1-4H3,(H,34,37)(H,35,38) |
| InChIKey | FBWYGJSOPOTLIB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|