C16H20F6N4O9 — CID 172958983
(5Z)-5-amino-5-hydroxyiminopentanoic acid;4-(5-methyl-1,2,4-oxadiazol-3-yl)butanoic acid;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate (PubChem CID 172958983) has the molecular formula C16H20F6N4O9 and a molecular weight of 526.34 g/mol. Its IUPAC name is (5Z)-5-amino-5-hydroxyiminopentanoic acid;4-(5-methyl-1,2,4-oxadiazol-3-yl)butanoic acid;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate.
| Compound Name | (5Z)-5-amino-5-hydroxyiminopentanoic acid;4-(5-methyl-1,2,4-oxadiazol-3-yl)butanoic acid;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 172958983 |
| Molecular Formula | C16H20F6N4O9 |
| Molecular Weight | 526.34 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | (5Z)-5-amino-5-hydroxyiminopentanoic acid;4-(5-methyl-1,2,4-oxadiazol-3-yl)butanoic acid;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
| SMILES | Cc1nc(CCCC(=O)O)no1.N/C(CCCC(=O)O)=N\O.O=C(OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H10N2O3.C5H10N2O3.C4F6O3/c1-5-8-6(9-12-5)3-2-4-7(10)11;6-4(7-10)2-1-3-5(8)9;5-3(6,7)1(11)13-2(12)4(8,9)10/h2-4H2,1H3,(H,10,11);10H,1-3H2,(H2,6,7)(H,8,9); |
| InChIKey | RRVXDBSZPACQMY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 215.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|