C19H26IN3O5S — CID 172960023
tert-butyl 2-[(Z)-[3-[(2S,3S)-2-(iodomethyl)-4-oxoazetidin-3-yl]-1-(2-methyl-1,3-thiazol-4-yl)-2-oxopropylidene]amino]oxy-2-methylpropanoate (PubChem CID 172960023) has the molecular formula C19H26IN3O5S and a molecular weight of 535.40 g/mol. Its IUPAC name is tert-butyl 2-[(Z)-[3-[(2S,3S)-2-(iodomethyl)-4-oxoazetidin-3-yl]-1-(2-methyl-1,3-thiazol-4-yl)-2-oxopropylidene]amino]oxy-2-methylpropanoate.
| Compound Name | tert-butyl 2-[(Z)-[3-[(2S,3S)-2-(iodomethyl)-4-oxoazetidin-3-yl]-1-(2-methyl-1,3-thiazol-4-yl)-2-oxopropylidene]amino]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 172960023 |
| Molecular Formula | C19H26IN3O5S |
| Molecular Weight | 535.40 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | tert-butyl 2-[(Z)-[3-[(2S,3S)-2-(iodomethyl)-4-oxoazetidin-3-yl]-1-(2-methyl-1,3-thiazol-4-yl)-2-oxopropylidene]amino]oxy-2-methylpropanoate |
| SMILES | Cc1nc(/C(=N/OC(C)(C)C(=O)OC(C)(C)C)C(=O)C[C@@H]2C(=O)N[C@@H]2CI)cs1 |
| InChI | InChI=1S/C19H26IN3O5S/c1-10-21-13(9-29-10)15(14(24)7-11-12(8-20)22-16(11)25)23-28-19(5,6)17(26)27-18(2,3)4/h9,11-12H,7-8H2,1-6H3,(H,22,25)/b23-15-/t11-,12+/m0/s1 |
| InChIKey | HACQLUGJFVZDLY-MJIMLXELSA-N |
| XLogP | 2.80 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|