C21H31N5O7S — CID 172950354
tert-butyl 2-[(Z)-[3-[(2S,3S)-2-(aminomethyl)-4-oxoazetidin-3-yl]-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-oxopropylidene]amino]oxyacetate (PubChem CID 172950354) has the molecular formula C21H31N5O7S and a molecular weight of 497.57 g/mol. Its IUPAC name is tert-butyl 2-[(Z)-[3-[(2S,3S)-2-(aminomethyl)-4-oxoazetidin-3-yl]-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-oxopropylidene]amino]oxyacetate.
| Compound Name | tert-butyl 2-[(Z)-[3-[(2S,3S)-2-(aminomethyl)-4-oxoazetidin-3-yl]-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-oxopropylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 172950354 |
| Molecular Formula | C21H31N5O7S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | tert-butyl 2-[(Z)-[3-[(2S,3S)-2-(aminomethyl)-4-oxoazetidin-3-yl]-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-oxopropylidene]amino]oxyacetate |
| SMILES | CC(C)(C)OC(=O)CO/N=C(\C(=O)C[C@@H]1C(=O)N[C@@H]1CN)c1csc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C21H31N5O7S/c1-20(2,3)32-15(28)9-31-26-16(14(27)7-11-12(8-22)23-17(11)29)13-10-34-18(24-13)25-19(30)33-21(4,5)6/h10-12H,7-9,22H2,1-6H3,(H,23,29)(H,24,25,30)/b26-16-/t11-,12+/m0/s1 |
| InChIKey | WMPVJWDIDASNSR-ALRFVURUSA-N |
| XLogP | 1.59 |
| TPSA | 171.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|