C16H11ClF6N2O2 — CID 172962430
(1Z)-N-hydroxy-2-(trifluoromethyl)benzenecarboximidoyl chloride;(NE)-N-[[2-(trifluoromethyl)phenyl]methylidene]hydroxylamine (PubChem CID 172962430) has the molecular formula C16H11ClF6N2O2 and a molecular weight of 412.72 g/mol. Its IUPAC name is (1Z)-N-hydroxy-2-(trifluoromethyl)benzenecarboximidoyl chloride;(NE)-N-[[2-(trifluoromethyl)phenyl]methylidene]hydroxylamine.
| Compound Name | (1Z)-N-hydroxy-2-(trifluoromethyl)benzenecarboximidoyl chloride;(NE)-N-[[2-(trifluoromethyl)phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 172962430 |
| Molecular Formula | C16H11ClF6N2O2 |
| Molecular Weight | 412.72 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | (1Z)-N-hydroxy-2-(trifluoromethyl)benzenecarboximidoyl chloride;(NE)-N-[[2-(trifluoromethyl)phenyl]methylidene]hydroxylamine |
| SMILES | O/N=C(\Cl)c1ccccc1C(F)(F)F.O/N=C/c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C8H5ClF3NO.C8H6F3NO/c9-7(13-14)5-3-1-2-4-6(5)8(10,11)12;9-8(10,11)7-4-2-1-3-6(7)5-12-13/h1-4,14H;1-5,13H/b13-7-;12-5+ |
| InChIKey | VDGBPMSNEDVNBN-KTXGUPKGSA-N |
| XLogP | 5.59 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.72 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|