C23H27N5O5S — CID 172964294
(1S)-3-[2-(benzylsulfonylamino)acetyl]-N-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 172964294) has the molecular formula C23H27N5O5S and a molecular weight of 485.57 g/mol. Its IUPAC name is (1S)-3-[2-(benzylsulfonylamino)acetyl]-N-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1S)-3-[2-(benzylsulfonylamino)acetyl]-N-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 172964294 |
| Molecular Formula | C23H27N5O5S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | (1S)-3-[2-(benzylsulfonylamino)acetyl]-N-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | N/C(=N\O)c1ccc(CNC(=O)C2[C@H]3CC3CN2C(=O)CNS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H27N5O5S/c24-22(27-31)17-8-6-15(7-9-17)11-25-23(30)21-19-10-18(19)13-28(21)20(29)12-26-34(32,33)14-16-4-2-1-3-5-16/h1-9,18-19,21,26,31H,10-14H2,(H2,24,27)(H,25,30)/t18?,19-,21?/m0/s1 |
| InChIKey | QNPZMRXXAYKSNC-SCCNAQOGSA-N |
| XLogP | 0.36 |
| TPSA | 154.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|