C35H43N7O7S — CID 123391076
11-(benzylsulfonylamino)-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2,10,17-trioxo-3,9,16-triazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-8-carboxamide (PubChem CID 123391076) has the molecular formula C35H43N7O7S and a molecular weight of 705.84 g/mol. Its IUPAC name is 11-(benzylsulfonylamino)-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2,10,17-trioxo-3,9,16-triazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-8-carboxamide.
| Compound Name | 11-(benzylsulfonylamino)-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2,10,17-trioxo-3,9,16-triazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-8-carboxamide |
|---|---|
| PubChem CID | 123391076 |
| Molecular Formula | C35H43N7O7S |
| Molecular Weight | 705.84 g/mol |
| Exact Mass | 705.29 |
| IUPAC Name | 11-(benzylsulfonylamino)-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-2,10,17-trioxo-3,9,16-triazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-8-carboxamide |
| SMILES | NC(=NO)c1ccc(CNC(=O)C2CCCCNC(=O)c3cccc(c3)C(=O)NCCCCC(NS(=O)(=O)Cc3ccccc3)C(=O)N2)cc1 |
| InChI | InChI=1S/C35H43N7O7S/c36-31(41-47)26-17-15-24(16-18-26)22-39-34(45)29-13-4-6-19-37-32(43)27-11-8-12-28(21-27)33(44)38-20-7-5-14-30(35(46)40-29)42-50(48,49)23-25-9-2-1-3-10-25/h1-3,8-12,15-18,21,29-30,42,47H,4-7,13-14,19-20,22-23H2,(H2,36,41)(H,37,43)(H,38,44)(H,39,45)(H,40,46) |
| InChIKey | DHAOQLABGCVUSW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 221.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.84 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|