C15H25NO — CID 172965097
(5Z)-8-cyclooctyl-2,3,4,8-tetrahydro-1H-azocin-7-one (PubChem CID 172965097) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (5Z)-8-cyclooctyl-2,3,4,8-tetrahydro-1H-azocin-7-one.
| Compound Name | (5Z)-8-cyclooctyl-2,3,4,8-tetrahydro-1H-azocin-7-one |
|---|---|
| PubChem CID | 172965097 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (5Z)-8-cyclooctyl-2,3,4,8-tetrahydro-1H-azocin-7-one |
| SMILES | O=C1/C=C\CCCNC1C1CCCCCCC1 |
| InChI | InChI=1S/C15H25NO/c17-14-11-7-4-8-12-16-15(14)13-9-5-2-1-3-6-10-13/h7,11,13,15-16H,1-6,8-10,12H2/b11-7- |
| InChIKey | IRXNYRXDBHYHGO-XFFZJAGNSA-N |
| XLogP | 3.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |