C19H33NO2 — CID 123687819
(E)-5,7,7,9-tetramethyl-9-[[(E)-2-oxopent-3-enyl]amino]dec-2-en-4-one (PubChem CID 123687819) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is (E)-5,7,7,9-tetramethyl-9-[[(E)-2-oxopent-3-enyl]amino]dec-2-en-4-one.
| Compound Name | (E)-5,7,7,9-tetramethyl-9-[[(E)-2-oxopent-3-enyl]amino]dec-2-en-4-one |
|---|---|
| PubChem CID | 123687819 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | (E)-5,7,7,9-tetramethyl-9-[[(E)-2-oxopent-3-enyl]amino]dec-2-en-4-one |
| SMILES | C/C=C/C(=O)CNC(C)(C)CC(C)(C)CC(C)C(=O)/C=C/C |
| InChI | InChI=1S/C19H33NO2/c1-8-10-16(21)13-20-19(6,7)14-18(4,5)12-15(3)17(22)11-9-2/h8-11,15,20H,12-14H2,1-7H3/b10-8+,11-9+ |
| InChIKey | NXPBTHDAYWKQMZ-GFULKKFKSA-N |
| XLogP | 4.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|