C30H49NO4 — CID 58445888
4-(7-butyl-8-oxoundecyl)-5-[3-oxo-2-(propylamino)hexyl]cyclohexa-3,5-diene-1,2-dione (PubChem CID 58445888) has the molecular formula C30H49NO4 and a molecular weight of 487.73 g/mol. Its IUPAC name is 4-(7-butyl-8-oxoundecyl)-5-[3-oxo-2-(propylamino)hexyl]cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-(7-butyl-8-oxoundecyl)-5-[3-oxo-2-(propylamino)hexyl]cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 58445888 |
| Molecular Formula | C30H49NO4 |
| Molecular Weight | 487.73 g/mol |
| Exact Mass | 487.37 |
| IUPAC Name | 4-(7-butyl-8-oxoundecyl)-5-[3-oxo-2-(propylamino)hexyl]cyclohexa-3,5-diene-1,2-dione |
| SMILES | CCCCC(CCCCCCC1=CC(=O)C(=O)C=C1CC(NCCC)C(=O)CCC)C(=O)CCC |
| InChI | InChI=1S/C30H49NO4/c1-5-9-16-23(27(32)14-6-2)17-12-10-11-13-18-24-21-29(34)30(35)22-25(24)20-26(31-19-8-4)28(33)15-7-3/h21-23,26,31H,5-20H2,1-4H3 |
| InChIKey | UMVLLQWHWRNXIP-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.73 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|