C13H21NO2 — CID 168665463
5,6-dimethyl-2-(pentan-3-ylamino)cyclohex-4-ene-1,3-dione (PubChem CID 168665463) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 5,6-dimethyl-2-(pentan-3-ylamino)cyclohex-4-ene-1,3-dione.
| Compound Name | 5,6-dimethyl-2-(pentan-3-ylamino)cyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 168665463 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 5,6-dimethyl-2-(pentan-3-ylamino)cyclohex-4-ene-1,3-dione |
| SMILES | CCC(CC)NC1C(=O)C=C(C)C(C)C1=O |
| InChI | InChI=1S/C13H21NO2/c1-5-10(6-2)14-12-11(15)7-8(3)9(4)13(12)16/h7,9-10,12,14H,5-6H2,1-4H3 |
| InChIKey | SUJUQNNKNVYASG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|