C12H23NO — CID 89053063
(3R)-3,8-dimethyl-3-(methylamino)non-7-en-2-one (PubChem CID 89053063) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (3R)-3,8-dimethyl-3-(methylamino)non-7-en-2-one.
| Compound Name | (3R)-3,8-dimethyl-3-(methylamino)non-7-en-2-one |
|---|---|
| PubChem CID | 89053063 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (3R)-3,8-dimethyl-3-(methylamino)non-7-en-2-one |
| SMILES | CN[C@](C)(CCCC=C(C)C)C(C)=O |
| InChI | InChI=1S/C12H23NO/c1-10(2)8-6-7-9-12(4,13-5)11(3)14/h8,13H,6-7,9H2,1-5H3/t12-/m1/s1 |
| InChIKey | KJMIZUHIOFINLN-GFCCVEGCSA-N |
| XLogP | 2.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|