C32H57N3O3 — CID 139335666
3-methyl-3-[[4-methyl-4-[[3-methyl-3-(methylamino)-2-oxooct-7-enyl]amino]-3-oxonon-8-enyl]amino]undec-10-en-2-one (PubChem CID 139335666) has the molecular formula C32H57N3O3 and a molecular weight of 531.83 g/mol. Its IUPAC name is 3-methyl-3-[[4-methyl-4-[[3-methyl-3-(methylamino)-2-oxooct-7-enyl]amino]-3-oxonon-8-enyl]amino]undec-10-en-2-one.
| Compound Name | 3-methyl-3-[[4-methyl-4-[[3-methyl-3-(methylamino)-2-oxooct-7-enyl]amino]-3-oxonon-8-enyl]amino]undec-10-en-2-one |
|---|---|
| PubChem CID | 139335666 |
| Molecular Formula | C32H57N3O3 |
| Molecular Weight | 531.83 g/mol |
| Exact Mass | 531.44 |
| IUPAC Name | 3-methyl-3-[[4-methyl-4-[[3-methyl-3-(methylamino)-2-oxooct-7-enyl]amino]-3-oxonon-8-enyl]amino]undec-10-en-2-one |
| SMILES | C=CCCCCCCC(C)(NCCC(=O)C(C)(CCCC=C)NCC(=O)C(C)(CCCC=C)NC)C(C)=O |
| InChI | InChI=1S/C32H57N3O3/c1-9-12-15-16-17-20-22-30(5,27(4)36)34-25-21-28(37)32(7,24-19-14-11-3)35-26-29(38)31(6,33-8)23-18-13-10-2/h9-11,33-35H,1-3,12-26H2,4-8H3 |
| InChIKey | GXZNJMLDEOYGNG-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.83 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|