C36H55N3O10P2 — CID 139426889
[4-[(2S)-2-[[4-methyl-4-(methylamino)-3-oxododec-11-enyl]amino]-3-oxo-5-[[(2S)-3-oxo-1-(4-phosphonooxyphenyl)butan-2-yl]amino]pentyl]phenyl]methylphosphonic acid (PubChem CID 139426889) has the molecular formula C36H55N3O10P2 and a molecular weight of 751.80 g/mol. Its IUPAC name is [4-[(2S)-2-[[4-methyl-4-(methylamino)-3-oxododec-11-enyl]amino]-3-oxo-5-[[(2S)-3-oxo-1-(4-phosphonooxyphenyl)butan-2-yl]amino]pentyl]phenyl]methylphosphonic acid.
| Compound Name | [4-[(2S)-2-[[4-methyl-4-(methylamino)-3-oxododec-11-enyl]amino]-3-oxo-5-[[(2S)-3-oxo-1-(4-phosphonooxyphenyl)butan-2-yl]amino]pentyl]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 139426889 |
| Molecular Formula | C36H55N3O10P2 |
| Molecular Weight | 751.80 g/mol |
| Exact Mass | 751.34 |
| IUPAC Name | [4-[(2S)-2-[[4-methyl-4-(methylamino)-3-oxododec-11-enyl]amino]-3-oxo-5-[[(2S)-3-oxo-1-(4-phosphonooxyphenyl)butan-2-yl]amino]pentyl]phenyl]methylphosphonic acid |
| SMILES | C=CCCCCCCC(C)(NC)C(=O)CCN[C@@H](Cc1ccc(CP(=O)(O)O)cc1)C(=O)CCN[C@@H](Cc1ccc(OP(=O)(O)O)cc1)C(C)=O |
| InChI | InChI=1S/C36H55N3O10P2/c1-5-6-7-8-9-10-21-36(3,37-4)35(42)20-23-39-33(25-28-11-13-30(14-12-28)26-50(43,44)45)34(41)19-22-38-32(27(2)40)24-29-15-17-31(18-16-29)49-51(46,47)48/h5,11-18,32-33,37-39H,1,6-10,19-26H2,2-4H3,(H2,43,44,45)(H2,46,47,48)/t32-,33-,36?/m0/s1 |
| InChIKey | NUZKXSVCUYMVHA-JTXQMZLCSA-N |
| XLogP | 4.55 |
| TPSA | 211.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|