C12H20O2S — CID 150404068
3-acetyl-3,7-dimethyl-2-sulfanyloct-6-enal (PubChem CID 150404068) has the molecular formula C12H20O2S and a molecular weight of 228.36 g/mol. Its IUPAC name is 3-acetyl-3,7-dimethyl-2-sulfanyloct-6-enal.
| Compound Name | 3-acetyl-3,7-dimethyl-2-sulfanyloct-6-enal |
|---|---|
| PubChem CID | 150404068 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 3-acetyl-3,7-dimethyl-2-sulfanyloct-6-enal |
| SMILES | CC(=O)C(C)(CCC=C(C)C)C(S)C=O |
| InChI | InChI=1S/C12H20O2S/c1-9(2)6-5-7-12(4,10(3)14)11(15)8-13/h6,8,11,15H,5,7H2,1-4H3 |
| InChIKey | HEJNVRSRCXNOSR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|