About S-tert-butyl 6-methylhept-5-enethioate
S-tert-butyl 6-methylhept-5-enethioate (PubChem CID 86189138) has the molecular formula C12H22OS
and a molecular weight of 214.37 g/mol. Its IUPAC name is S-tert-butyl 6-methylhept-5-enethioate.
Molecular Properties
| Compound Name | S-tert-butyl 6-methylhept-5-enethioate |
| PubChem CID | 86189138 |
| Molecular Formula | C12H22OS |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | S-tert-butyl 6-methylhept-5-enethioate |
| SMILES | CC(C)=CCCCC(=O)SC(C)(C)C |
| InChI | InChI=1S/C12H22OS/c1-10(2)8-6-7-9-11(13)14-12(3,4)5/h8H,6-7,9H2,1-5H3 |
| InChIKey | ADOOYODFRBYKOS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-tert-butyl 6-methylhept-5-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-tert-butyl 6-methylhept-5-enethioate?
The IUPAC name of S-tert-butyl 6-methylhept-5-enethioate (CID 86189138) is S-tert-butyl 6-methylhept-5-enethioate.
What is the SMILES notation for S-tert-butyl 6-methylhept-5-enethioate?
The canonical SMILES for S-tert-butyl 6-methylhept-5-enethioate is CC(C)=CCCCC(=O)SC(C)(C)C.
What is the InChIKey of S-tert-butyl 6-methylhept-5-enethioate?
The InChIKey is ADOOYODFRBYKOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22OS/c1-10(2)8-6-7-9-11(13)14-12(3,4)5/h8H,6-7,9H2,1-5H3.
What are the key properties of S-tert-butyl 6-methylhept-5-enethioate?
S-tert-butyl 6-methylhept-5-enethioate has a molecular weight of 214.37 g/mol, XLogP of 4.18, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-tert-butyl 6-methylhept-5-enethioate is sourced from PubChem (CID 86189138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).