C19H33NO — CID 46934066
(2E,6E,10R,11R)-10-(butylamino)-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one (PubChem CID 46934066) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is (2E,6E,10R,11R)-10-(butylamino)-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one.
| Compound Name | (2E,6E,10R,11R)-10-(butylamino)-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one |
|---|---|
| PubChem CID | 46934066 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | (2E,6E,10R,11R)-10-(butylamino)-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one |
| SMILES | CCCCN[C@@H]1CC/C(C)=C/CC(C)(C)/C=C/C(=O)[C@@H]1C |
| InChI | InChI=1S/C19H33NO/c1-6-7-14-20-17-9-8-15(2)10-12-19(4,5)13-11-18(21)16(17)3/h10-11,13,16-17,20H,6-9,12,14H2,1-5H3/b13-11+,15-10+/t16-,17-/m1/s1 |
| InChIKey | ZHFMEJHXJUGNMP-IHUMOJNTSA-N |
| XLogP | 4.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|