C13H9FN2O4 — CID 172965103
5-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-1,3-diazinane-2,4,6-trione (PubChem CID 172965103) has the molecular formula C13H9FN2O4 and a molecular weight of 276.22 g/mol. Its IUPAC name is 5-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 172965103 |
| Molecular Formula | C13H9FN2O4 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 5-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(C(=O)/C=C/c2ccc(F)cc2)C(=O)N1 |
| InChI | InChI=1S/C13H9FN2O4/c14-8-4-1-7(2-5-8)3-6-9(17)10-11(18)15-13(20)16-12(10)19/h1-6,10H,(H2,15,16,18,19,20)/b6-3+ |
| InChIKey | OUUMUZRVETVCKP-ZZXKWVIFSA-N |
| XLogP | 0.39 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|