C22H21NO3S — CID 17296525
ethyl 3-[[2-(naphthalen-2-ylmethylsulfanyl)acetyl]amino]benzoate (PubChem CID 17296525) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is ethyl 3-[[2-(naphthalen-2-ylmethylsulfanyl)acetyl]amino]benzoate.
| Compound Name | ethyl 3-[[2-(naphthalen-2-ylmethylsulfanyl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 17296525 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | ethyl 3-[[2-(naphthalen-2-ylmethylsulfanyl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)CSCc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C22H21NO3S/c1-2-26-22(25)19-8-5-9-20(13-19)23-21(24)15-27-14-16-10-11-17-6-3-4-7-18(17)12-16/h3-13H,2,14-15H2,1H3,(H,23,24) |
| InChIKey | VTQDKRHMWHIBJI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |