C21H33NO3 — CID 172965709
(3S,8S,9S,10R,13S,14S,17S)-17-[(Z)-N-hydroxy-C-(hydroxymethyl)carbonimidoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 172965709) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17S)-17-[(Z)-N-hydroxy-C-(hydroxymethyl)carbonimidoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(Z)-N-hydroxy-C-(hydroxymethyl)carbonimidoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 172965709 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(Z)-N-hydroxy-C-(hydroxymethyl)carbonimidoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@@]43C)[C@@H]1CC[C@@H]2/C(CO)=N/O |
| InChI | InChI=1S/C21H33NO3/c1-20-9-7-14(24)11-13(20)3-4-15-16-5-6-18(19(12-23)22-25)21(16,2)10-8-17(15)20/h3,14-18,23-25H,4-12H2,1-2H3/b22-19+/t14-,15-,16-,17-,18+,20-,21-/m0/s1 |
| InChIKey | PESIUEHSKJSKMT-XCMCMVRXSA-N |
| XLogP | 3.75 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|