C22H14F8N4O9 — CID 172966367
3-fluoro-5-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid;3-fluoro-5-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate (PubChem CID 172966367) has the molecular formula C22H14F8N4O9 and a molecular weight of 630.36 g/mol. Its IUPAC name is 3-fluoro-5-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid;3-fluoro-5-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate.
| Compound Name | 3-fluoro-5-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid;3-fluoro-5-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 172966367 |
| Molecular Formula | C22H14F8N4O9 |
| Molecular Weight | 630.36 g/mol |
| Exact Mass | 630.06 |
| IUPAC Name | 3-fluoro-5-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid;3-fluoro-5-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
| SMILES | Cc1nc(-c2cc(F)cc(C(=O)O)c2)no1.N/C(=N\O)c1cc(F)cc(C(=O)O)c1.O=C(OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H7FN2O3.C8H7FN2O3.C4F6O3/c1-5-12-9(13-16-5)6-2-7(10(14)15)4-8(11)3-6;9-6-2-4(7(10)11-14)1-5(3-6)8(12)13;5-3(6,7)1(11)13-2(12)4(8,9)10/h2-4H,1H3,(H,14,15);1-3,14H,(H2,10,11)(H,12,13); |
| InChIKey | MKYCQLOFPQYSLJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 215.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|