C16H11F2N3O5 — CID 172919480
3-fluoro-5-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid;3-fluoro-5-isocyanobenzoic acid (PubChem CID 172919480) has the molecular formula C16H11F2N3O5 and a molecular weight of 363.28 g/mol. Its IUPAC name is 3-fluoro-5-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid;3-fluoro-5-isocyanobenzoic acid.
| Compound Name | 3-fluoro-5-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid;3-fluoro-5-isocyanobenzoic acid |
|---|---|
| PubChem CID | 172919480 |
| Molecular Formula | C16H11F2N3O5 |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 3-fluoro-5-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid;3-fluoro-5-isocyanobenzoic acid |
| SMILES | N/C(=N\O)c1cc(F)cc(C(=O)O)c1.[C-]#[N+]c1cc(F)cc(C(=O)O)c1 |
| InChI | InChI=1S/C8H7FN2O3.C8H4FNO2/c9-6-2-4(7(10)11-14)1-5(3-6)8(12)13;1-10-7-3-5(8(11)12)2-6(9)4-7/h1-3,14H,(H2,10,11)(H,12,13);2-4H,(H,11,12) |
| InChIKey | ZUNRRVHABMURKY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|