C13H15FN2O2 — CID 164527247
3-[(Z)-1-amino-2-(methyliminomethyl)but-1-enyl]-5-fluorobenzoic acid (PubChem CID 164527247) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is 3-[(Z)-1-amino-2-(methyliminomethyl)but-1-enyl]-5-fluorobenzoic acid.
| Compound Name | 3-[(Z)-1-amino-2-(methyliminomethyl)but-1-enyl]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 164527247 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-[(Z)-1-amino-2-(methyliminomethyl)but-1-enyl]-5-fluorobenzoic acid |
| SMILES | CCC(/C=N/C)=C(/N)c1cc(F)cc(C(=O)O)c1 |
| InChI | InChI=1S/C13H15FN2O2/c1-3-8(7-16-2)12(15)9-4-10(13(17)18)6-11(14)5-9/h4-7H,3,15H2,1-2H3,(H,17,18)/b12-8-,16-7+ |
| InChIKey | CHUGPZHVOVTPAX-COAJZOOHSA-N |
| XLogP | 2.30 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|