C13H12F4N2O2 — CID 164527106
3-[C-[(E)-1-amino-3,3,3-trifluoroprop-1-en-2-yl]-N-ethylcarbonimidoyl]-5-fluorobenzoic acid (PubChem CID 164527106) has the molecular formula C13H12F4N2O2 and a molecular weight of 304.24 g/mol. Its IUPAC name is 3-[C-[(E)-1-amino-3,3,3-trifluoroprop-1-en-2-yl]-N-ethylcarbonimidoyl]-5-fluorobenzoic acid.
| Compound Name | 3-[C-[(E)-1-amino-3,3,3-trifluoroprop-1-en-2-yl]-N-ethylcarbonimidoyl]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 164527106 |
| Molecular Formula | C13H12F4N2O2 |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-[C-[(E)-1-amino-3,3,3-trifluoroprop-1-en-2-yl]-N-ethylcarbonimidoyl]-5-fluorobenzoic acid |
| SMILES | CC/N=C(C(=C\N)/C(F)(F)F)\c1cc(F)cc(C(=O)O)c1 |
| InChI | InChI=1S/C13H12F4N2O2/c1-2-19-11(10(6-18)13(15,16)17)7-3-8(12(20)21)5-9(14)4-7/h3-6H,2,18H2,1H3,(H,20,21)/b10-6+,19-11+ |
| InChIKey | URPHGIJRSGKWRA-ABILJCPISA-N |
| XLogP | 2.74 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|