C11H9F4NO3 — CID 138540664
3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid (PubChem CID 138540664) has the molecular formula C11H9F4NO3 and a molecular weight of 279.19 g/mol. Its IUPAC name is 3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid.
| Compound Name | 3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 138540664 |
| Molecular Formula | C11H9F4NO3 |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid |
| SMILES | O=C(O)c1cc(F)cc(CCNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F4NO3/c12-8-4-6(3-7(5-8)9(17)18)1-2-16-10(19)11(13,14)15/h3-5H,1-2H2,(H,16,19)(H,17,18) |
| InChIKey | VUZRYNKOTUOFAF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |