3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid

C11H9F4NO3 — CID 138540664

IUPAC3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid
SMILESO=C(O)c1cc(F)cc(CCNC(=O)C(F)(F)F)c1
InChIInChI=1S/C11H9F4NO3/c12-8-4-6(3-7(5-8)9(17)18)1-2-16-10(19)11(13,14)15/h3-5H,1-2H2,(H,16,19)(H,17,18)
InChIKeyVUZRYNKOTUOFAF-UHFFFAOYSA-N
MW279.19 g/mol
LogP1.74
Rot. Bonds4

About 3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid

3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid (PubChem CID 138540664) has the molecular formula C11H9F4NO3 and a molecular weight of 279.19 g/mol. Its IUPAC name is 3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid.

Molecular Properties

Compound Name3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid
PubChem CID138540664
Molecular FormulaC11H9F4NO3
Molecular Weight279.19 g/mol
Exact Mass279.05
IUPAC Name3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid
SMILESO=C(O)c1cc(F)cc(CCNC(=O)C(F)(F)F)c1
InChIInChI=1S/C11H9F4NO3/c12-8-4-6(3-7(5-8)9(17)18)1-2-16-10(19)11(13,14)15/h3-5H,1-2H2,(H,16,19)(H,17,18)
InChIKeyVUZRYNKOTUOFAF-UHFFFAOYSA-N
XLogP1.74
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.19
LogP ≤ 51.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid?
The IUPAC name of 3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid (CID 138540664) is 3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid.
What is the SMILES notation for 3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid?
The canonical SMILES for 3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid is O=C(O)c1cc(F)cc(CCNC(=O)C(F)(F)F)c1.
What is the InChIKey of 3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid?
The InChIKey is VUZRYNKOTUOFAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F4NO3/c12-8-4-6(3-7(5-8)9(17)18)1-2-16-10(19)11(13,14)15/h3-5H,1-2H2,(H,16,19)(H,17,18).
What are the key properties of 3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid?
3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid has a molecular weight of 279.19 g/mol, XLogP of 1.74, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-5-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzoic acid is sourced from PubChem (CID 138540664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).