C19H16Cl3NO4 — CID 172967263
(2E)-2-[2-[[2-chloro-3-(2,2-dichloroethenyl)phenoxy]methyl]phenyl]-2-ethoxyiminoacetic acid (PubChem CID 172967263) has the molecular formula C19H16Cl3NO4 and a molecular weight of 428.70 g/mol. Its IUPAC name is (2E)-2-[2-[[2-chloro-3-(2,2-dichloroethenyl)phenoxy]methyl]phenyl]-2-ethoxyiminoacetic acid.
| Compound Name | (2E)-2-[2-[[2-chloro-3-(2,2-dichloroethenyl)phenoxy]methyl]phenyl]-2-ethoxyiminoacetic acid |
|---|---|
| PubChem CID | 172967263 |
| Molecular Formula | C19H16Cl3NO4 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | (2E)-2-[2-[[2-chloro-3-(2,2-dichloroethenyl)phenoxy]methyl]phenyl]-2-ethoxyiminoacetic acid |
| SMILES | CCO/N=C(/C(=O)O)c1ccccc1COc1cccc(C=C(Cl)Cl)c1Cl |
| InChI | InChI=1S/C19H16Cl3NO4/c1-2-27-23-18(19(24)25)14-8-4-3-6-13(14)11-26-15-9-5-7-12(17(15)22)10-16(20)21/h3-10H,2,11H2,1H3,(H,24,25)/b23-18+ |
| InChIKey | GTQBVKVXFOZNEW-PTGBLXJZSA-N |
| XLogP | 5.52 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|