C8H8ClNO10S3 — CID 172969456
2-(3-chlorosulfonyl-5-nitrophenyl)sulfonylethyl hydrogen sulfate (PubChem CID 172969456) has the molecular formula C8H8ClNO10S3 and a molecular weight of 409.80 g/mol. Its IUPAC name is 2-(3-chlorosulfonyl-5-nitrophenyl)sulfonylethyl hydrogen sulfate.
| Compound Name | 2-(3-chlorosulfonyl-5-nitrophenyl)sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 172969456 |
| Molecular Formula | C8H8ClNO10S3 |
| Molecular Weight | 409.80 g/mol |
| Exact Mass | 408.90 |
| IUPAC Name | 2-(3-chlorosulfonyl-5-nitrophenyl)sulfonylethyl hydrogen sulfate |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Cl)cc(S(=O)(=O)CCOS(=O)(=O)O)c1 |
| InChI | InChI=1S/C8H8ClNO10S3/c9-22(15,16)8-4-6(10(11)12)3-7(5-8)21(13,14)2-1-20-23(17,18)19/h3-5H,1-2H2,(H,17,18,19) |
| InChIKey | UDYXNOZTFKKTQY-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 175.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.80 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|