C24H23N3O5 — CID 172970042
(1-benzhydryl-3-methyl-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazin-5-yl)oxymethyl acetate (PubChem CID 172970042) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is (1-benzhydryl-3-methyl-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazin-5-yl)oxymethyl acetate.
| Compound Name | (1-benzhydryl-3-methyl-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazin-5-yl)oxymethyl acetate |
|---|---|
| PubChem CID | 172970042 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | (1-benzhydryl-3-methyl-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazin-5-yl)oxymethyl acetate |
| SMILES | CC(=O)OCOc1c2n(ccc1=O)N(C(c1ccccc1)c1ccccc1)CN(C)C2=O |
| InChI | InChI=1S/C24H23N3O5/c1-17(28)31-16-32-23-20(29)13-14-26-22(23)24(30)25(2)15-27(26)21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-14,21H,15-16H2,1-2H3 |
| InChIKey | GVJKZJHDYAQVBU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|