C21H29N3O3S — CID 162689022
5-hydroxy-3-methyl-1-(1-phenylbutyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione;propane-2-thiol (PubChem CID 162689022) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is 5-hydroxy-3-methyl-1-(1-phenylbutyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione;propane-2-thiol.
| Compound Name | 5-hydroxy-3-methyl-1-(1-phenylbutyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione;propane-2-thiol |
|---|---|
| PubChem CID | 162689022 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 5-hydroxy-3-methyl-1-(1-phenylbutyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione;propane-2-thiol |
| SMILES | CC(C)S.CCCC(c1ccccc1)N1CN(C)C(=O)c2c(O)c(=O)ccn21 |
| InChI | InChI=1S/C18H21N3O3.C3H8S/c1-3-7-14(13-8-5-4-6-9-13)21-12-19(2)18(24)16-17(23)15(22)10-11-20(16)21;1-3(2)4/h4-6,8-11,14,23H,3,7,12H2,1-2H3;3-4H,1-2H3 |
| InChIKey | GDQLYMSZLDPFNF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|