C27H27F2N3O4 — CID 167283186
3-[(2S)-butan-2-yl]-1-[(R)-(3,4-difluoro-2-prop-2-enoxyphenyl)-phenylmethyl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 167283186) has the molecular formula C27H27F2N3O4 and a molecular weight of 495.53 g/mol. Its IUPAC name is 3-[(2S)-butan-2-yl]-1-[(R)-(3,4-difluoro-2-prop-2-enoxyphenyl)-phenylmethyl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 3-[(2S)-butan-2-yl]-1-[(R)-(3,4-difluoro-2-prop-2-enoxyphenyl)-phenylmethyl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 167283186 |
| Molecular Formula | C27H27F2N3O4 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 3-[(2S)-butan-2-yl]-1-[(R)-(3,4-difluoro-2-prop-2-enoxyphenyl)-phenylmethyl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | C=CCOc1c(C(c2ccccc2)N2CN([C@@H](C)CC)C(=O)c3c(O)c(=O)ccn32)ccc(F)c1F |
| InChI | InChI=1S/C27H27F2N3O4/c1-4-15-36-26-19(11-12-20(28)22(26)29)23(18-9-7-6-8-10-18)32-16-30(17(3)5-2)27(35)24-25(34)21(33)13-14-31(24)32/h4,6-14,17,23,34H,1,5,15-16H2,2-3H3/t17-,23?/m0/s1 |
| InChIKey | BCSMPAPBWFCHCV-NVHKAFQKSA-N |
| XLogP | 4.34 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|