C26H26ClN3O4 — CID 167283056
1-benzyl-3-[(E,3S)-6-(3-chlorophenoxy)hex-4-en-3-yl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 167283056) has the molecular formula C26H26ClN3O4 and a molecular weight of 479.96 g/mol. Its IUPAC name is 1-benzyl-3-[(E,3S)-6-(3-chlorophenoxy)hex-4-en-3-yl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 1-benzyl-3-[(E,3S)-6-(3-chlorophenoxy)hex-4-en-3-yl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 167283056 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 1-benzyl-3-[(E,3S)-6-(3-chlorophenoxy)hex-4-en-3-yl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | CC[C@@H](/C=C/COc1cccc(Cl)c1)N1CN(Cc2ccccc2)n2ccc(=O)c(O)c2C1=O |
| InChI | InChI=1S/C26H26ClN3O4/c1-2-21(11-7-15-34-22-12-6-10-20(27)16-22)29-18-28(17-19-8-4-3-5-9-19)30-14-13-23(31)25(32)24(30)26(29)33/h3-14,16,21,32H,2,15,17-18H2,1H3/b11-7+/t21-/m0/s1 |
| InChIKey | FOATWQMAIFBHFL-AKERNLMBSA-N |
| XLogP | 4.17 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|