C26H25ClN4O3 — CID 121364647
N-[2-(3-chlorophenoxy)ethyl]-3-methyl-1-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]pyrazole-4-carboxamide (PubChem CID 121364647) has the molecular formula C26H25ClN4O3 and a molecular weight of 476.96 g/mol. Its IUPAC name is N-[2-(3-chlorophenoxy)ethyl]-3-methyl-1-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]pyrazole-4-carboxamide.
| Compound Name | N-[2-(3-chlorophenoxy)ethyl]-3-methyl-1-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121364647 |
| Molecular Formula | C26H25ClN4O3 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | N-[2-(3-chlorophenoxy)ethyl]-3-methyl-1-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(Cc2ccc(Cn3ccccc3=O)cc2)cc1C(=O)NCCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C26H25ClN4O3/c1-19-24(26(33)28-12-14-34-23-6-4-5-22(27)15-23)18-31(29-19)17-21-10-8-20(9-11-21)16-30-13-3-2-7-25(30)32/h2-11,13,15,18H,12,14,16-17H2,1H3,(H,28,33) |
| InChIKey | PKQDYDRNWWAIES-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|