C24H26ClN5O3 — CID 121364564
3-amino-N-[2-(3-chlorophenoxy)ethyl]-1-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]pyrazole-4-carboxamide (PubChem CID 121364564) has the molecular formula C24H26ClN5O3 and a molecular weight of 467.96 g/mol. Its IUPAC name is 3-amino-N-[2-(3-chlorophenoxy)ethyl]-1-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]pyrazole-4-carboxamide.
| Compound Name | 3-amino-N-[2-(3-chlorophenoxy)ethyl]-1-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121364564 |
| Molecular Formula | C24H26ClN5O3 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 3-amino-N-[2-(3-chlorophenoxy)ethyl]-1-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]pyrazole-4-carboxamide |
| SMILES | Nc1nn(Cc2cccc(C(=O)N3CCCC3)c2)cc1C(=O)NCCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H26ClN5O3/c25-19-7-4-8-20(14-19)33-12-9-27-23(31)21-16-30(28-22(21)26)15-17-5-3-6-18(13-17)24(32)29-10-1-2-11-29/h3-8,13-14,16H,1-2,9-12,15H2,(H2,26,28)(H,27,31) |
| InChIKey | FDSBGTCPRVRSDQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|