C20H19ClN6O2 — CID 121364657
5-amino-N-[2-(3-chlorophenoxy)ethyl]-1-(1H-indazol-5-ylmethyl)pyrazole-4-carboxamide (PubChem CID 121364657) has the molecular formula C20H19ClN6O2 and a molecular weight of 410.87 g/mol. Its IUPAC name is 5-amino-N-[2-(3-chlorophenoxy)ethyl]-1-(1H-indazol-5-ylmethyl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-N-[2-(3-chlorophenoxy)ethyl]-1-(1H-indazol-5-ylmethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121364657 |
| Molecular Formula | C20H19ClN6O2 |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 5-amino-N-[2-(3-chlorophenoxy)ethyl]-1-(1H-indazol-5-ylmethyl)pyrazole-4-carboxamide |
| SMILES | Nc1c(C(=O)NCCOc2cccc(Cl)c2)cnn1Cc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C20H19ClN6O2/c21-15-2-1-3-16(9-15)29-7-6-23-20(28)17-11-25-27(19(17)22)12-13-4-5-18-14(8-13)10-24-26-18/h1-5,8-11H,6-7,12,22H2,(H,23,28)(H,24,26) |
| InChIKey | PKPGYVUOAXVWSZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|