C22H25ClN6O2 — CID 121364648
3-amino-N-[2-(3-chlorophenoxy)ethyl]-1-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]pyrazole-4-carboxamide (PubChem CID 121364648) has the molecular formula C22H25ClN6O2 and a molecular weight of 440.94 g/mol. Its IUPAC name is 3-amino-N-[2-(3-chlorophenoxy)ethyl]-1-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]pyrazole-4-carboxamide.
| Compound Name | 3-amino-N-[2-(3-chlorophenoxy)ethyl]-1-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121364648 |
| Molecular Formula | C22H25ClN6O2 |
| Molecular Weight | 440.94 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 3-amino-N-[2-(3-chlorophenoxy)ethyl]-1-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]pyrazole-4-carboxamide |
| SMILES | Nc1nn(Cc2ccc(N3CCCC3)nc2)cc1C(=O)NCCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H25ClN6O2/c23-17-4-3-5-18(12-17)31-11-8-25-22(30)19-15-29(27-21(19)24)14-16-6-7-20(26-13-16)28-9-1-2-10-28/h3-7,12-13,15H,1-2,8-11,14H2,(H2,24,27)(H,25,30) |
| InChIKey | GLDWFNRLYGEHRT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.94 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|