C27H28BrF2N3O4 — CID 168831839
(2S)-2-(2-bromoethyl)-5-butoxy-1-[(3,4-difluoro-2-hydroxyphenyl)-phenylmethyl]-3-methyl-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 168831839) has the molecular formula C27H28BrF2N3O4 and a molecular weight of 576.44 g/mol. Its IUPAC name is (2S)-2-(2-bromoethyl)-5-butoxy-1-[(3,4-difluoro-2-hydroxyphenyl)-phenylmethyl]-3-methyl-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | (2S)-2-(2-bromoethyl)-5-butoxy-1-[(3,4-difluoro-2-hydroxyphenyl)-phenylmethyl]-3-methyl-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 168831839 |
| Molecular Formula | C27H28BrF2N3O4 |
| Molecular Weight | 576.44 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | (2S)-2-(2-bromoethyl)-5-butoxy-1-[(3,4-difluoro-2-hydroxyphenyl)-phenylmethyl]-3-methyl-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | CCCCOc1c2n(ccc1=O)N(C(c1ccccc1)c1ccc(F)c(F)c1O)[C@@H](CCBr)N(C)C2=O |
| InChI | InChI=1S/C27H28BrF2N3O4/c1-3-4-16-37-26-20(34)13-15-32-24(26)27(36)31(2)21(12-14-28)33(32)23(17-8-6-5-7-9-17)18-10-11-19(29)22(30)25(18)35/h5-11,13,15,21,23,35H,3-4,12,14,16H2,1-2H3/t21-,23?/m0/s1 |
| InChIKey | OMDLWOHVGVVDQM-BBQAJUCSSA-N |
| XLogP | 4.94 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|