C27H26ClN3O2 — CID 130421009
(8S)-8-benzhydryl-13-butoxy-5-chloro-3,6,9-triazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one (PubChem CID 130421009) has the molecular formula C27H26ClN3O2 and a molecular weight of 459.98 g/mol. Its IUPAC name is (8S)-8-benzhydryl-13-butoxy-5-chloro-3,6,9-triazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one.
| Compound Name | (8S)-8-benzhydryl-13-butoxy-5-chloro-3,6,9-triazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one |
|---|---|
| PubChem CID | 130421009 |
| Molecular Formula | C27H26ClN3O2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (8S)-8-benzhydryl-13-butoxy-5-chloro-3,6,9-triazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one |
| SMILES | CCCCOc1c2n(ccc1=O)[C@@H](C(c1ccccc1)c1ccccc1)Cn1c(Cl)cnc1-2 |
| InChI | InChI=1S/C27H26ClN3O2/c1-2-3-16-33-26-22(32)14-15-30-21(18-31-23(28)17-29-27(31)25(26)30)24(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15,17,21,24H,2-3,16,18H2,1H3/t21-/m1/s1 |
| InChIKey | BCIRQLDDRVTYGT-OAQYLSRUSA-N |
| XLogP | 5.93 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|