C23H19N3O2 — CID 175127114
8-benzhydryl-13-hydroxy-3,6,9-triazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one (PubChem CID 175127114) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 8-benzhydryl-13-hydroxy-3,6,9-triazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one.
| Compound Name | 8-benzhydryl-13-hydroxy-3,6,9-triazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one |
|---|---|
| PubChem CID | 175127114 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 8-benzhydryl-13-hydroxy-3,6,9-triazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one |
| SMILES | O=c1ccn2c(c1O)-c1nccn1CC2C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19N3O2/c27-19-11-13-26-18(15-25-14-12-24-23(25)21(26)22(19)28)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,18,20,28H,15H2 |
| InChIKey | PNSZYGZIWVOPBV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |