C15H20N2O3 — CID 90245194
(4R)-9-butoxy-4-methylspiro[2,4-dihydropyrido[1,2-a]pyrazine-3,1'-cyclopropane]-1,8-dione (PubChem CID 90245194) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is (4R)-9-butoxy-4-methylspiro[2,4-dihydropyrido[1,2-a]pyrazine-3,1'-cyclopropane]-1,8-dione.
| Compound Name | (4R)-9-butoxy-4-methylspiro[2,4-dihydropyrido[1,2-a]pyrazine-3,1'-cyclopropane]-1,8-dione |
|---|---|
| PubChem CID | 90245194 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (4R)-9-butoxy-4-methylspiro[2,4-dihydropyrido[1,2-a]pyrazine-3,1'-cyclopropane]-1,8-dione |
| SMILES | CCCCOc1c2n(ccc1=O)[C@H](C)C1(CC1)NC2=O |
| InChI | InChI=1S/C15H20N2O3/c1-3-4-9-20-13-11(18)5-8-17-10(2)15(6-7-15)16-14(19)12(13)17/h5,8,10H,3-4,6-7,9H2,1-2H3,(H,16,19)/t10-/m1/s1 |
| InChIKey | WCGUOMUUPFGYJW-SNVBAGLBSA-N |
| XLogP | 1.86 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|