C17H24N2O4 — CID 122485475
(3S,7R)-11-butoxy-3,7-dimethyl-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 122485475) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is (3S,7R)-11-butoxy-3,7-dimethyl-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3S,7R)-11-butoxy-3,7-dimethyl-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 122485475 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (3S,7R)-11-butoxy-3,7-dimethyl-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | CCCCOc1c2n(ccc1=O)C[C@]1(C)OCC[C@@H](C)N1C2=O |
| InChI | InChI=1S/C17H24N2O4/c1-4-5-9-22-15-13(20)6-8-18-11-17(3)19(16(21)14(15)18)12(2)7-10-23-17/h6,8,12H,4-5,7,9-11H2,1-3H3/t12-,17+/m1/s1 |
| InChIKey | NVAAKNCVGYIQGZ-PXAZEXFGSA-N |
| XLogP | 2.01 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|