C20H24F2N2O5 — CID 90328295
ethyl (1R,11R,12S)-5-butoxy-14,14-difluoro-3,6-dioxo-2,9-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-4,7-diene-7-carboxylate (PubChem CID 90328295) has the molecular formula C20H24F2N2O5 and a molecular weight of 410.42 g/mol. Its IUPAC name is ethyl (1R,11R,12S)-5-butoxy-14,14-difluoro-3,6-dioxo-2,9-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-4,7-diene-7-carboxylate.
| Compound Name | ethyl (1R,11R,12S)-5-butoxy-14,14-difluoro-3,6-dioxo-2,9-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-4,7-diene-7-carboxylate |
|---|---|
| PubChem CID | 90328295 |
| Molecular Formula | C20H24F2N2O5 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | ethyl (1R,11R,12S)-5-butoxy-14,14-difluoro-3,6-dioxo-2,9-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-4,7-diene-7-carboxylate |
| SMILES | CCCCOc1c2n(cc(C(=O)OCC)c1=O)C[C@H]1[C@H]3C[C@@H](N1C2=O)C(F)(F)C3 |
| InChI | InChI=1S/C20H24F2N2O5/c1-3-5-6-29-17-15-18(26)24-13(11-7-14(24)20(21,22)8-11)10-23(15)9-12(16(17)25)19(27)28-4-2/h9,11,13-14H,3-8,10H2,1-2H3/t11-,13-,14+/m0/s1 |
| InChIKey | IEHDPWTZAVAMFQ-FPMFFAJLSA-N |
| XLogP | 2.46 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|