C24H26ClF2N3O4 — CID 130333426
(3R,4R)-9-butoxy-N-[(5-chloro-2,4-difluorophenyl)methyl]-4-ethyl-7,10-dioxo-1,6-diazatricyclo[6.4.0.03,6]dodeca-8,11-diene-11-carboxamide (PubChem CID 130333426) has the molecular formula C24H26ClF2N3O4 and a molecular weight of 493.94 g/mol. Its IUPAC name is (3R,4R)-9-butoxy-N-[(5-chloro-2,4-difluorophenyl)methyl]-4-ethyl-7,10-dioxo-1,6-diazatricyclo[6.4.0.03,6]dodeca-8,11-diene-11-carboxamide.
| Compound Name | (3R,4R)-9-butoxy-N-[(5-chloro-2,4-difluorophenyl)methyl]-4-ethyl-7,10-dioxo-1,6-diazatricyclo[6.4.0.03,6]dodeca-8,11-diene-11-carboxamide |
|---|---|
| PubChem CID | 130333426 |
| Molecular Formula | C24H26ClF2N3O4 |
| Molecular Weight | 493.94 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | (3R,4R)-9-butoxy-N-[(5-chloro-2,4-difluorophenyl)methyl]-4-ethyl-7,10-dioxo-1,6-diazatricyclo[6.4.0.03,6]dodeca-8,11-diene-11-carboxamide |
| SMILES | CCCCOc1c2n(cc(C(=O)NCc3cc(Cl)c(F)cc3F)c1=O)C[C@H]1[C@H](CC)CN1C2=O |
| InChI | InChI=1S/C24H26ClF2N3O4/c1-3-5-6-34-22-20-24(33)30-10-13(4-2)19(30)12-29(20)11-15(21(22)31)23(32)28-9-14-7-16(25)18(27)8-17(14)26/h7-8,11,13,19H,3-6,9-10,12H2,1-2H3,(H,28,32)/t13-,19+/m1/s1 |
| InChIKey | IJGCJXOFIRUOPT-YJYMSZOUSA-N |
| XLogP | 3.75 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.94 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|