C30H26F3N3O4 — CID 123742686
14-methyl-3,6-dioxo-5-phenylmethoxy-N-[(2,4,5-trifluorophenyl)methyl]-2,9-diazapentacyclo[10.3.1.02,11.04,9.013,15]hexadeca-4,7-diene-7-carboxamide (PubChem CID 123742686) has the molecular formula C30H26F3N3O4 and a molecular weight of 549.55 g/mol. Its IUPAC name is 14-methyl-3,6-dioxo-5-phenylmethoxy-N-[(2,4,5-trifluorophenyl)methyl]-2,9-diazapentacyclo[10.3.1.02,11.04,9.013,15]hexadeca-4,7-diene-7-carboxamide.
| Compound Name | 14-methyl-3,6-dioxo-5-phenylmethoxy-N-[(2,4,5-trifluorophenyl)methyl]-2,9-diazapentacyclo[10.3.1.02,11.04,9.013,15]hexadeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 123742686 |
| Molecular Formula | C30H26F3N3O4 |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 14-methyl-3,6-dioxo-5-phenylmethoxy-N-[(2,4,5-trifluorophenyl)methyl]-2,9-diazapentacyclo[10.3.1.02,11.04,9.013,15]hexadeca-4,7-diene-7-carboxamide |
| SMILES | CC1C2C3CC(C12)N1C(=O)c2c(OCc4ccccc4)c(=O)c(C(=O)NCc4cc(F)c(F)cc4F)cn2CC31 |
| InChI | InChI=1S/C30H26F3N3O4/c1-14-24-17-8-22(25(14)24)36-23(17)12-35-11-18(29(38)34-10-16-7-20(32)21(33)9-19(16)31)27(37)28(26(35)30(36)39)40-13-15-5-3-2-4-6-15/h2-7,9,11,14,17,22-25H,8,10,12-13H2,1H3,(H,34,38) |
| InChIKey | QTNRNCYJSGHKNY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|