C21H21ClFN3O4 — CID 130333856
(10R,11S)-N-[(4-chloro-2-fluorophenyl)methyl]-4-hydroxy-11-methyl-2,5-dioxo-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide (PubChem CID 130333856) has the molecular formula C21H21ClFN3O4 and a molecular weight of 433.87 g/mol. Its IUPAC name is (10R,11S)-N-[(4-chloro-2-fluorophenyl)methyl]-4-hydroxy-11-methyl-2,5-dioxo-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide.
| Compound Name | (10R,11S)-N-[(4-chloro-2-fluorophenyl)methyl]-4-hydroxy-11-methyl-2,5-dioxo-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide |
|---|---|
| PubChem CID | 130333856 |
| Molecular Formula | C21H21ClFN3O4 |
| Molecular Weight | 433.87 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | (10R,11S)-N-[(4-chloro-2-fluorophenyl)methyl]-4-hydroxy-11-methyl-2,5-dioxo-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide |
| SMILES | C[C@H]1CCCN2C(=O)c3c(O)c(=O)c(C(=O)NCc4ccc(Cl)cc4F)cn3C[C@@H]12 |
| InChI | InChI=1S/C21H21ClFN3O4/c1-11-3-2-6-26-16(11)10-25-9-14(18(27)19(28)17(25)21(26)30)20(29)24-8-12-4-5-13(22)7-15(12)23/h4-5,7,9,11,16,28H,2-3,6,8,10H2,1H3,(H,24,29)/t11-,16-/m0/s1 |
| InChIKey | HSFVNDFKEPDJHZ-ZBEGNZNMSA-N |
| XLogP | 2.53 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.87 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |