C23H24ClF2N3O5 — CID 122597309
(9R,11R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-4-hydroxy-9-(methoxymethyl)-11-methyl-2,5-dioxo-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide (PubChem CID 122597309) has the molecular formula C23H24ClF2N3O5 and a molecular weight of 495.91 g/mol. Its IUPAC name is (9R,11R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-4-hydroxy-9-(methoxymethyl)-11-methyl-2,5-dioxo-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide.
| Compound Name | (9R,11R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-4-hydroxy-9-(methoxymethyl)-11-methyl-2,5-dioxo-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide |
|---|---|
| PubChem CID | 122597309 |
| Molecular Formula | C23H24ClF2N3O5 |
| Molecular Weight | 495.91 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | (9R,11R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-4-hydroxy-9-(methoxymethyl)-11-methyl-2,5-dioxo-1,8-diazatricyclo[8.4.0.03,8]tetradeca-3,6-diene-6-carboxamide |
| SMILES | COC[C@H]1C2[C@H](C)CCCN2C(=O)c2c(O)c(=O)c(C(=O)NCc3ccc(F)c(Cl)c3F)cn21 |
| InChI | InChI=1S/C23H24ClF2N3O5/c1-11-4-3-7-28-18(11)15(10-34-2)29-9-13(20(30)21(31)19(29)23(28)33)22(32)27-8-12-5-6-14(25)16(24)17(12)26/h5-6,9,11,15,18,31H,3-4,7-8,10H2,1-2H3,(H,27,32)/t11-,15+,18?/m1/s1 |
| InChIKey | IIDOBQVJDMPRID-BMHIVAMDSA-N |
| XLogP | 2.86 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.91 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|